Tropaeolin OO
Encyclopedia
| Acid orange 5 | |
|---|---|
| Common name Common name A common name of a taxon or organism is a name in general use within a community; it is often contrasted with the scientific name for the same organism... |
acid orange 5 |
| Systematic name Systematic name A systematic name is a name given in a systematic way to one unique group, organism, object or chemical substance, out of a specific population or collection... |
sodium 4--(phenylamino)phenyl]azo]benzenesulfonate |
| Chemical formula Chemical formula A chemical formula or molecular formula is a way of expressing information about the atoms that constitute a particular chemical compound.... |
NaC18H14SN3O3 |
| CAS number | 554-73-4 |
Acid orange 5 is a compound with formula Na(C6H5NHC6H4N=NC6H4SO3). It is a dye
Dye
A dye is a colored substance that has an affinity to the substrate to which it is being applied. The dye is generally applied in an aqueous solution, and requires a mordant to improve the fastness of the dye on the fiber....
.