Bismarck brown R
Encyclopedia
| Bismarck brown R | |
|---|---|
| Common name Common name A common name of a taxon or organism is a name in general use within a community; it is often contrasted with the scientific name for the same organism... |
Bismarck brown R |
| Systematic name Systematic name A systematic name is a name given in a systematic way to one unique group, organism, object or chemical substance, out of a specific population or collection... |
[5-amino-4-[5-(2-amino-4-azaniumyl-5-methylphenyl)diazenyl-2-methylphe nyl]diazenyl-2-methylphenyl]azanium dichloride |
| Chemical formula Chemical formula A chemical formula or molecular formula is a way of expressing information about the atoms that constitute a particular chemical compound.... |
C21H26Cl2N8 |
| CAS number | 8005-78-5 |
Bismarck brown R is a compound with formula
CH5C6H3Cl2(CH3C6H2(NH2)2N2)2. It is a dye
Dye
A dye is a colored substance that has an affinity to the substrate to which it is being applied. The dye is generally applied in an aqueous solution, and requires a mordant to improve the fastness of the dye on the fiber....
.